C18H28F2N4O2 — CID 111287719
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 111287719) has the molecular formula C18H28F2N4O2 and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111287719 |
| Molecular Formula | C18H28F2N4O2 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H28F2N4O2/c1-4-21-18(22-11-16-13-23(2)9-10-25-16)24(3)12-14-5-7-15(8-6-14)26-17(19)20/h5-8,16-17H,4,9-13H2,1-3H3,(H,21,22) |
| InChIKey | RYTYFWAWWYPZQA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|