About 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one
1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one (PubChem CID 11128828) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 11128828 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one |
| SMILES | CCc1cc2c(n1Cc1ccccc1)CCCC2=O |
| InChI | InChI=1S/C17H19NO/c1-2-14-11-15-16(9-6-10-17(15)19)18(14)12-13-7-4-3-5-8-13/h3-5,7-8,11H,2,6,9-10,12H2,1H3 |
| InChIKey | WAZKIRPFJTZRDA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one (CID 11128828) is 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one is CCc1cc2c(n1Cc1ccccc1)CCCC2=O.
What is the InChIKey of 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one?
The InChIKey is WAZKIRPFJTZRDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-2-14-11-15-16(9-6-10-17(15)19)18(14)12-13-7-4-3-5-8-13/h3-5,7-8,11H,2,6,9-10,12H2,1H3.
What are the key properties of 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one?
1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one has a molecular weight of 253.34 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-ethyl-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 11128828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).