C19H30F2N4O2 — CID 111288319
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine (PubChem CID 111288319) has the molecular formula C19H30F2N4O2 and a molecular weight of 384.47 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111288319 |
| Molecular Formula | C19H30F2N4O2 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-(4-morpholin-4-ylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCN1CCOCC1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H30F2N4O2/c1-22-19(23-9-3-4-10-25-11-13-26-14-12-25)24(2)15-16-5-7-17(8-6-16)27-18(20)21/h5-8,18H,3-4,9-15H2,1-2H3,(H,22,23) |
| InChIKey | GNCGUOJANAMFBM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|