C17H26F2N4O2 — CID 111288709
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 111288709) has the molecular formula C17H26F2N4O2 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111288709 |
| Molecular Formula | C17H26F2N4O2 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCC1CN(C)CCO1)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H26F2N4O2/c1-20-17(21-10-15-12-22(2)8-9-24-15)23(3)11-13-4-6-14(7-5-13)25-16(18)19/h4-7,15-16H,8-12H2,1-3H3,(H,20,21) |
| InChIKey | PUBRZAHPIINTLV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|