About 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal
3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal (PubChem CID 11128880) has the molecular formula C14H26O2Si
and a molecular weight of 254.45 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal |
| PubChem CID | 11128880 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal |
| SMILES | C#CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C=O |
| InChI | InChI=1S/C14H26O2Si/c1-9-10-12(14(5,6)11-15)16-17(7,8)13(2,3)4/h1,11-12H,10H2,2-8H3 |
| InChIKey | SAIYASCAOKXLML-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal (CID 11128880) is 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal is C#CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C=O.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal?
The InChIKey is SAIYASCAOKXLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2Si/c1-9-10-12(14(5,6)11-15)16-17(7,8)13(2,3)4/h1,11-12H,10H2,2-8H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal?
3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal has a molecular weight of 254.45 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-5-ynal is sourced from PubChem (CID 11128880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).