About 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate
4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate (PubChem CID 11128927) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate |
| PubChem CID | 11128927 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CNCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-5-17-10(15)9-8-13-6-7-14(9)11(16)18-12(2,3)4/h8,13H,5-7H2,1-4H3 |
| InChIKey | MTOHQDDJVYIXLQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate?
The IUPAC name of 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate (CID 11128927) is 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate.
What is the SMILES notation for 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate?
The canonical SMILES for 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate is CCOC(=O)C1=CNCCN1C(=O)OC(C)(C)C.
What is the InChIKey of 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate?
The InChIKey is MTOHQDDJVYIXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-5-17-10(15)9-8-13-6-7-14(9)11(16)18-12(2,3)4/h8,13H,5-7H2,1-4H3.
What are the key properties of 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate?
4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate has a molecular weight of 256.30 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 5-O-ethyl 2,3-dihydro-1H-pyrazine-4,5-dicarboxylate is sourced from PubChem (CID 11128927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).