About CID 11129064
CID 11129064 (PubChem CID 11129064) has the molecular formula C10H18O4Si2
and a molecular weight of 258.42 g/mol.
Molecular Properties
| Compound Name | CID 11129064 |
| PubChem CID | 11129064 |
| Molecular Formula | C10H18O4Si2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | — |
| SMILES | COC(=O)/C(=C(\C(=O)OC)[Si](C)C)[Si](C)C |
| InChI | InChI=1S/C10H18O4Si2/c1-13-9(11)7(15(3)4)8(16(5)6)10(12)14-2/h1-6H3/b8-7- |
| InChIKey | WHRQUCBUANSJJV-FPLPWBNLSA-N |
| XLogP | 1.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11129064 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11129064?
The IUPAC name of CID 11129064 (CID 11129064) is not available.
What is the SMILES notation for CID 11129064?
The canonical SMILES for CID 11129064 is COC(=O)/C(=C(\C(=O)OC)[Si](C)C)[Si](C)C.
What is the InChIKey of CID 11129064?
The InChIKey is WHRQUCBUANSJJV-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H18O4Si2/c1-13-9(11)7(15(3)4)8(16(5)6)10(12)14-2/h1-6H3/b8-7-.
What are the key properties of CID 11129064?
CID 11129064 has a molecular weight of 258.42 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11129064 is sourced from PubChem (CID 11129064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).