C21H32N6O — CID 111292209
1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111292209) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111292209 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[2-(1-methylpyrazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1cnn(C)c1)NCC(c1ccc(OC)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H32N6O/c1-22-21(23-11-10-17-14-25-26(2)16-17)24-15-20(27-12-4-5-13-27)18-6-8-19(28-3)9-7-18/h6-9,14,16,20H,4-5,10-13,15H2,1-3H3,(H2,22,23,24) |
| InChIKey | OQJLAAGZBVGFGC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|