C15H22O4 — CID 11129253
[(1Z)-1-[(4S,5R)-5-methyl-4-(4-methylpent-3-enyl)-2-oxooxolan-3-ylidene]ethyl] acetate (PubChem CID 11129253) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(1Z)-1-[(4S,5R)-5-methyl-4-(4-methylpent-3-enyl)-2-oxooxolan-3-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-1-[(4S,5R)-5-methyl-4-(4-methylpent-3-enyl)-2-oxooxolan-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 11129253 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(1Z)-1-[(4S,5R)-5-methyl-4-(4-methylpent-3-enyl)-2-oxooxolan-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\C(=O)O[C@H](C)[C@H]1CCC=C(C)C |
| InChI | InChI=1S/C15H22O4/c1-9(2)7-6-8-13-10(3)19-15(17)14(13)11(4)18-12(5)16/h7,10,13H,6,8H2,1-5H3/b14-11-/t10-,13-/m1/s1 |
| InChIKey | PXGNORFSSSCAQN-MRGAIZKKSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|