About (2,3,6-trimethylphenyl) trifluoromethanesulfonate
(2,3,6-trimethylphenyl) trifluoromethanesulfonate (PubChem CID 11129299) has the molecular formula C10H11F3O3S
and a molecular weight of 268.26 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2,3,6-trimethylphenyl) trifluoromethanesulfonate |
| PubChem CID | 11129299 |
| Molecular Formula | C10H11F3O3S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (2,3,6-trimethylphenyl) trifluoromethanesulfonate |
| SMILES | Cc1ccc(C)c(OS(=O)(=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C10H11F3O3S/c1-6-4-5-7(2)9(8(6)3)16-17(14,15)10(11,12)13/h4-5H,1-3H3 |
| InChIKey | DMAZPHOECBSZFG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2,3,6-trimethylphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,6-trimethylphenyl) trifluoromethanesulfonate?
The IUPAC name of (2,3,6-trimethylphenyl) trifluoromethanesulfonate (CID 11129299) is (2,3,6-trimethylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (2,3,6-trimethylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (2,3,6-trimethylphenyl) trifluoromethanesulfonate is Cc1ccc(C)c(OS(=O)(=O)C(F)(F)F)c1C.
What is the InChIKey of (2,3,6-trimethylphenyl) trifluoromethanesulfonate?
The InChIKey is DMAZPHOECBSZFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3O3S/c1-6-4-5-7(2)9(8(6)3)16-17(14,15)10(11,12)13/h4-5H,1-3H3.
What are the key properties of (2,3,6-trimethylphenyl) trifluoromethanesulfonate?
(2,3,6-trimethylphenyl) trifluoromethanesulfonate has a molecular weight of 268.26 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,6-trimethylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 11129299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).