About 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal
4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal (PubChem CID 11129395) has the molecular formula C15H30O2Si
and a molecular weight of 270.49 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal |
| PubChem CID | 11129395 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal |
| SMILES | C=CC(C)(C)C(CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-9-15(5,6)13(11-10-12-16)17-18(7,8)14(2,3)4/h9,12-13H,1,10-11H2,2-8H3 |
| InChIKey | FEXSQEUCZZTFNW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal (CID 11129395) is 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal is C=CC(C)(C)C(CCC=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal?
The InChIKey is FEXSQEUCZZTFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2Si/c1-9-15(5,6)13(11-10-12-16)17-18(7,8)14(2,3)4/h9,12-13H,1,10-11H2,2-8H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal?
4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal has a molecular weight of 270.49 g/mol, XLogP of 4.57, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhept-6-enal is sourced from PubChem (CID 11129395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).