About N,N-dibenzyl-1,1-dimethoxymethanamine
N,N-dibenzyl-1,1-dimethoxymethanamine (PubChem CID 11129415) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is N,N-dibenzyl-1,1-dimethoxymethanamine.
Molecular Properties
| Compound Name | N,N-dibenzyl-1,1-dimethoxymethanamine |
| PubChem CID | 11129415 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N,N-dibenzyl-1,1-dimethoxymethanamine |
| SMILES | COC(OC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO2/c1-19-17(20-2)18(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | KDMLAMZWWKELQT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibenzyl-1,1-dimethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-1,1-dimethoxymethanamine?
The IUPAC name of N,N-dibenzyl-1,1-dimethoxymethanamine (CID 11129415) is N,N-dibenzyl-1,1-dimethoxymethanamine.
What is the SMILES notation for N,N-dibenzyl-1,1-dimethoxymethanamine?
The canonical SMILES for N,N-dibenzyl-1,1-dimethoxymethanamine is COC(OC)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-1,1-dimethoxymethanamine?
The InChIKey is KDMLAMZWWKELQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-19-17(20-2)18(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3.
What are the key properties of N,N-dibenzyl-1,1-dimethoxymethanamine?
N,N-dibenzyl-1,1-dimethoxymethanamine has a molecular weight of 271.36 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-1,1-dimethoxymethanamine is sourced from PubChem (CID 11129415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).