C17H22ClIN4O2 — CID 111294798
2-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111294798) has the molecular formula C17H22ClIN4O2 and a molecular weight of 476.75 g/mol. Its IUPAC name is 2-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111294798 |
| Molecular Formula | C17H22ClIN4O2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 2-[[N-[(2-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCc1ccco1)N(C)Cc1ccccc1Cl.I |
| InChI | InChI=1S/C17H21ClN4O2.HI/c1-19-17(22(2)12-13-6-3-4-8-15(13)18)21-11-16(23)20-10-14-7-5-9-24-14;/h3-9H,10-12H2,1-2H3,(H,19,21)(H,20,23);1H |
| InChIKey | PXCZKQQXYDNVHD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|