C14H13NO5 — CID 11129519
methyl (1S,2R,6R,7S,9R)-4-phenyl-5,8,10-trioxa-3-azatricyclo[5.2.1.02,6]dec-3-ene-9-carboxylate (PubChem CID 11129519) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl (1S,2R,6R,7S,9R)-4-phenyl-5,8,10-trioxa-3-azatricyclo[5.2.1.02,6]dec-3-ene-9-carboxylate.
| Compound Name | methyl (1S,2R,6R,7S,9R)-4-phenyl-5,8,10-trioxa-3-azatricyclo[5.2.1.02,6]dec-3-ene-9-carboxylate |
|---|---|
| PubChem CID | 11129519 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl (1S,2R,6R,7S,9R)-4-phenyl-5,8,10-trioxa-3-azatricyclo[5.2.1.02,6]dec-3-ene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H]2O[C@H]1[C@H]1N=C(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C14H13NO5/c1-17-13(16)11-9-8-10(14(19-9)20-11)18-12(15-8)7-5-3-2-4-6-7/h2-6,8-11,14H,1H3/t8-,9+,10-,11-,14+/m1/s1 |
| InChIKey | IVEXBTGSZACMAL-UKRLYRRISA-N |
| XLogP | 0.50 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |