C20H30F3IN4O — CID 111295718
2-methyl-1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295718) has the molecular formula C20H30F3IN4O and a molecular weight of 526.39 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295718 |
| Molecular Formula | C20H30F3IN4O |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 2-methyl-1-[3-(2-oxopyrrolidin-1-yl)pentyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCC(CCN/C(=N\C)NCCc1ccc(C(F)(F)F)cc1)N1CCCC1=O.I |
| InChI | InChI=1S/C20H29F3N4O.HI/c1-3-17(27-14-4-5-18(27)28)11-13-26-19(24-2)25-12-10-15-6-8-16(9-7-15)20(21,22)23;/h6-9,17H,3-5,10-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | NIHFWLCIRYYIKO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|