C21H30IN3O5 — CID 111296422
methyl 5-[[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111296422) has the molecular formula C21H30IN3O5 and a molecular weight of 531.39 g/mol. Its IUPAC name is methyl 5-[[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111296422 |
| Molecular Formula | C21H30IN3O5 |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | methyl 5-[[[[(2,4-dimethoxyphenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(=O)OC)c(C)o1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H29N3O5.HI/c1-7-22-21(23-12-17-10-18(14(2)29-17)20(25)28-6)24(3)13-15-8-9-16(26-4)11-19(15)27-5;/h8-11H,7,12-13H2,1-6H3,(H,22,23);1H |
| InChIKey | NFJRUPYALRMNML-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|