C17H28O3 — CID 11129699
1-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one (PubChem CID 11129699) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one.
| Compound Name | 1-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one |
|---|---|
| PubChem CID | 11129699 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(1R,2R,4aS,8aR)-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3,3-dimethoxypropan-1-one |
| SMILES | COC(CC(=O)[C@]1(C)[C@H](C)C=C[C@@H]2CCCC[C@H]21)OC |
| InChI | InChI=1S/C17H28O3/c1-12-9-10-13-7-5-6-8-14(13)17(12,2)15(18)11-16(19-3)20-4/h9-10,12-14,16H,5-8,11H2,1-4H3/t12-,13+,14-,17-/m1/s1 |
| InChIKey | NFIODMAKFWCOIU-UMPJEAMMSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|