C14H18O6 — CID 11129744
(1R,4S,5S)-4-[(1S,2S)-1,2-dihydroxy-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]ethyl]-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 11129744) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (1R,4S,5S)-4-[(1S,2S)-1,2-dihydroxy-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]ethyl]-3-oxabicyclo[3.2.0]heptan-2-one.
| Compound Name | (1R,4S,5S)-4-[(1S,2S)-1,2-dihydroxy-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 11129744 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (1R,4S,5S)-4-[(1S,2S)-1,2-dihydroxy-2-[(1S,2S,5R)-4-oxo-3-oxabicyclo[3.2.0]heptan-2-yl]ethyl]-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | O=C1O[C@H]([C@@H](O)[C@H](O)[C@H]2OC(=O)[C@@H]3CC[C@H]23)[C@H]2CC[C@@H]12 |
| InChI | InChI=1S/C14H18O6/c15-9(11-5-1-3-7(5)13(17)19-11)10(16)12-6-2-4-8(6)14(18)20-12/h5-12,15-16H,1-4H2/t5-,6-,7+,8+,9-,10-,11-,12-/m0/s1 |
| InChIKey | MMFGTOOCPWVROQ-WVEHSUSFSA-N |
| XLogP | -0.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |