C22H34IN5O2 — CID 111298190
1-[1-(3,4-diethoxyphenyl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111298190) has the molecular formula C22H34IN5O2 and a molecular weight of 527.45 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111298190 |
| Molecular Formula | C22H34IN5O2 |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-[[2-(dimethylamino)-4-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ccc(C(C)N/C(=N/C)NCc2ccnc(N(C)C)c2)cc1OCC.I |
| InChI | InChI=1S/C22H33N5O2.HI/c1-7-28-19-10-9-18(14-20(19)29-8-2)16(3)26-22(23-4)25-15-17-11-12-24-21(13-17)27(5)6;/h9-14,16H,7-8,15H2,1-6H3,(H2,23,25,26);1H |
| InChIKey | IRZXCVJDPKTMSU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|