About magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide
magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide (PubChem CID 11129861) has the molecular formula C10H13BrMgO3
and a molecular weight of 285.42 g/mol. Its IUPAC name is magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide.
Molecular Properties
| Compound Name | magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide |
| PubChem CID | 11129861 |
| Molecular Formula | C10H13BrMgO3 |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide |
| SMILES | COCOc1c[c-]cc(C)c1OC.[Br-].[Mg+2] |
| InChI | InChI=1S/C10H13O3.BrH.Mg/c1-8-5-4-6-9(10(8)12-3)13-7-11-2;;/h5-6H,7H2,1-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | HGMLAPNZZXECLU-UHFFFAOYSA-M |
| XLogP | -1.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide?
The IUPAC name of magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide (CID 11129861) is magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide.
What is the SMILES notation for magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide?
The canonical SMILES for magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide is COCOc1c[c-]cc(C)c1OC.[Br-].[Mg+2].
What is the InChIKey of magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide?
The InChIKey is HGMLAPNZZXECLU-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13O3.BrH.Mg/c1-8-5-4-6-9(10(8)12-3)13-7-11-2;;/h5-6H,7H2,1-3H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide?
magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide has a molecular weight of 285.42 g/mol, XLogP of -1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methoxy-1-(methoxymethoxy)-3-methylbenzene-5-ide;bromide is sourced from PubChem (CID 11129861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).