C21H36N4O2S — CID 111298811
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine (PubChem CID 111298811) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111298811 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-[4-(2-methylpropyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C21H36N4O2S/c1-5-22-21(23-10-11-25-12-14-28(26,27)15-13-25)24-18(4)20-8-6-19(7-9-20)16-17(2)3/h6-9,17-18H,5,10-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | WKVNJZZRLGVAEW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|