C19H30N4OS — CID 111298951
3-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 111298951) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111298951 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(4-methylsulfanylphenyl)methyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)N(C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C19H30N4OS/c1-4-20-19(21-14-18(24)23-12-6-5-7-13-23)22(2)15-16-8-10-17(25-3)11-9-16/h8-11H,4-7,12-15H2,1-3H3,(H,20,21) |
| InChIKey | NCAKGWVCJJMGAV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|