C16H19NO4 — CID 11129998
methyl (2R,4aR,10bR)-7-hydroxy-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinoline-2-carboxylate (PubChem CID 11129998) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl (2R,4aR,10bR)-7-hydroxy-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinoline-2-carboxylate.
| Compound Name | methyl (2R,4aR,10bR)-7-hydroxy-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11129998 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl (2R,4aR,10bR)-7-hydroxy-4-methyl-6-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f]quinoline-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2c3cccc(O)c3C(=O)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C16H19NO4/c1-17-8-9(16(20)21-2)6-11-10-4-3-5-13(18)15(10)14(19)7-12(11)17/h3-5,9,11-12,18H,6-8H2,1-2H3/t9-,11-,12-/m1/s1 |
| InChIKey | LPYYNHOXWIQLJF-YUSALJHKSA-N |
| XLogP | 1.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |