C18H26FIN4O2 — CID 111300430
N-[(4-fluorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111300430) has the molecular formula C18H26FIN4O2 and a molecular weight of 476.33 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111300430 |
| Molecular Formula | C18H26FIN4O2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(F)cc1)N1CCN(C(=O)C2CCCO2)CC1.I |
| InChI | InChI=1S/C18H25FN4O2.HI/c1-20-18(21-13-14-4-6-15(19)7-5-14)23-10-8-22(9-11-23)17(24)16-3-2-12-25-16;/h4-7,16H,2-3,8-13H2,1H3,(H,20,21);1H |
| InChIKey | LPCNOHQECYFSAI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|