C15H20N2O2S — CID 11130113
(3R,7S,7aS)-7-(2-aminophenyl)sulfanyl-3-ethyl-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 11130113) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is (3R,7S,7aS)-7-(2-aminophenyl)sulfanyl-3-ethyl-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (3R,7S,7aS)-7-(2-aminophenyl)sulfanyl-3-ethyl-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11130113 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (3R,7S,7aS)-7-(2-aminophenyl)sulfanyl-3-ethyl-7a-methyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | CC[C@@H]1CO[C@@]2(C)[C@@H](Sc3ccccc3N)CC(=O)N12 |
| InChI | InChI=1S/C15H20N2O2S/c1-3-10-9-19-15(2)13(8-14(18)17(10)15)20-12-7-5-4-6-11(12)16/h4-7,10,13H,3,8-9,16H2,1-2H3/t10-,13+,15+/m1/s1 |
| InChIKey | IDRYUIWSCSIOSH-DGFSRKRXSA-N |
| XLogP | 2.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|