C20H28O2 — CID 11130380
(3S,4E,11R,16R)-16-hydroxy-4,15,15-trimethyl-8-methylidenetricyclo[9.3.1.13,14]hexadeca-1(14),4-dien-2-one (PubChem CID 11130380) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (3S,4E,11R,16R)-16-hydroxy-4,15,15-trimethyl-8-methylidenetricyclo[9.3.1.13,14]hexadeca-1(14),4-dien-2-one.
| Compound Name | (3S,4E,11R,16R)-16-hydroxy-4,15,15-trimethyl-8-methylidenetricyclo[9.3.1.13,14]hexadeca-1(14),4-dien-2-one |
|---|---|
| PubChem CID | 11130380 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (3S,4E,11R,16R)-16-hydroxy-4,15,15-trimethyl-8-methylidenetricyclo[9.3.1.13,14]hexadeca-1(14),4-dien-2-one |
| SMILES | C=C1CC/C=C(/C)[C@@H]2C(=O)C3=C(CC[C@@H](CC1)C3(C)C)[C@@H]2O |
| InChI | InChI=1S/C20H28O2/c1-12-6-5-7-13(2)16-18(21)15-11-10-14(9-8-12)20(3,4)17(15)19(16)22/h7,14,16,18,21H,1,5-6,8-11H2,2-4H3/b13-7-/t14-,16+,18+/m1/s1 |
| InChIKey | NFIMVVUHGOJOGK-DBNFJLELSA-N |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|