C26H36N6O — CID 111305111
1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111305111) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111305111 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 1-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1c(C)nn(Cc2ccccc2)c1C)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C26H36N6O/c1-20-23(21(2)32(30-20)19-22-11-6-4-7-12-22)17-28-26(27-3)29-18-24(25-13-10-16-33-25)31-14-8-5-9-15-31/h4,6-7,10-13,16,24H,5,8-9,14-15,17-19H2,1-3H3,(H2,27,28,29) |
| InChIKey | HXDRMVARLOGRBB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|