About 10-methyl-3,7-bis(methylsulfanyl)phenothiazine
10-methyl-3,7-bis(methylsulfanyl)phenothiazine (PubChem CID 11130550) has the molecular formula C15H15NS3
and a molecular weight of 305.49 g/mol. Its IUPAC name is 10-methyl-3,7-bis(methylsulfanyl)phenothiazine.
Molecular Properties
| Compound Name | 10-methyl-3,7-bis(methylsulfanyl)phenothiazine |
| PubChem CID | 11130550 |
| Molecular Formula | C15H15NS3 |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 10-methyl-3,7-bis(methylsulfanyl)phenothiazine |
| SMILES | CSc1ccc2c(c1)Sc1cc(SC)ccc1N2C |
| InChI | InChI=1S/C15H15NS3/c1-16-12-6-4-10(17-2)8-14(12)19-15-9-11(18-3)5-7-13(15)16/h4-9H,1-3H3 |
| InChIKey | GJPXWRMODZYWNF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-methyl-3,7-bis(methylsulfanyl)phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-3,7-bis(methylsulfanyl)phenothiazine?
The IUPAC name of 10-methyl-3,7-bis(methylsulfanyl)phenothiazine (CID 11130550) is 10-methyl-3,7-bis(methylsulfanyl)phenothiazine.
What is the SMILES notation for 10-methyl-3,7-bis(methylsulfanyl)phenothiazine?
The canonical SMILES for 10-methyl-3,7-bis(methylsulfanyl)phenothiazine is CSc1ccc2c(c1)Sc1cc(SC)ccc1N2C.
What is the InChIKey of 10-methyl-3,7-bis(methylsulfanyl)phenothiazine?
The InChIKey is GJPXWRMODZYWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NS3/c1-16-12-6-4-10(17-2)8-14(12)19-15-9-11(18-3)5-7-13(15)16/h4-9H,1-3H3.
What are the key properties of 10-methyl-3,7-bis(methylsulfanyl)phenothiazine?
10-methyl-3,7-bis(methylsulfanyl)phenothiazine has a molecular weight of 305.49 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-3,7-bis(methylsulfanyl)phenothiazine is sourced from PubChem (CID 11130550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).