C21H27FN4O — CID 111307230
N-ethyl-3-[[[ethylamino-[(4-fluorophenyl)methyl-methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111307230) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is N-ethyl-3-[[[ethylamino-[(4-fluorophenyl)methyl-methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-ethyl-3-[[[ethylamino-[(4-fluorophenyl)methyl-methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111307230 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N-ethyl-3-[[[ethylamino-[(4-fluorophenyl)methyl-methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1cccc(C/N=C(\NCC)N(C)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H27FN4O/c1-4-23-20(27)18-8-6-7-17(13-18)14-25-21(24-5-2)26(3)15-16-9-11-19(22)12-10-16/h6-13H,4-5,14-15H2,1-3H3,(H,23,27)(H,24,25) |
| InChIKey | CXOQTDSABDJRDF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|