C23H32ClN5O2 — CID 111308400
3-[[[N-[2-(4-chlorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 111308400) has the molecular formula C23H32ClN5O2 and a molecular weight of 446.00 g/mol. Its IUPAC name is 3-[[[N-[2-(4-chlorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[[N-[2-(4-chlorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 111308400 |
| Molecular Formula | C23H32ClN5O2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 3-[[[N-[2-(4-chlorophenoxy)ethyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCCN(C)C)c1)N(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H32ClN5O2/c1-25-23(29(4)14-15-31-21-10-8-20(24)9-11-21)27-17-18-6-5-7-19(16-18)22(30)26-12-13-28(2)3/h5-11,16H,12-15,17H2,1-4H3,(H,25,27)(H,26,30) |
| InChIKey | QUCWDDOQGHLGEV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|