C25H35N5O2 — CID 111308630
4-[[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide (PubChem CID 111308630) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-[[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111308630 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 4-[[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]methyl]-N-methylbenzamide |
| SMILES | C/N=C(/NCc1ccc(C(=O)NC)cc1)NCC(c1ccc(OC)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H35N5O2/c1-26-24(31)21-9-7-19(8-10-21)17-28-25(27-2)29-18-23(30-15-5-4-6-16-30)20-11-13-22(32-3)14-12-20/h7-14,23H,4-6,15-18H2,1-3H3,(H,26,31)(H2,27,28,29) |
| InChIKey | FUIJEHBMMVBJLL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|