C20H29NO2 — CID 11130873
[(2R,4aS,4bR,8S,8aR,10aR)-8-(2-cyanoethyl)-7-methylidene-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] acetate (PubChem CID 11130873) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [(2R,4aS,4bR,8S,8aR,10aR)-8-(2-cyanoethyl)-7-methylidene-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] acetate.
| Compound Name | [(2R,4aS,4bR,8S,8aR,10aR)-8-(2-cyanoethyl)-7-methylidene-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 11130873 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [(2R,4aS,4bR,8S,8aR,10aR)-8-(2-cyanoethyl)-7-methylidene-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-yl] acetate |
| SMILES | C=C1CC[C@H]2[C@@H](CC[C@@H]3C[C@H](OC(C)=O)CC[C@@H]32)[C@@H]1CCC#N |
| InChI | InChI=1S/C20H29NO2/c1-13-5-8-20-18-10-7-16(23-14(2)22)12-15(18)6-9-19(20)17(13)4-3-11-21/h15-20H,1,3-10,12H2,2H3/t15-,16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | WZCRPUQKZVIOSM-QONVVCGCSA-N |
| XLogP | 4.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|