C21H36IN5O2 — CID 111308867
3-[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111308867) has the molecular formula C21H36IN5O2 and a molecular weight of 517.46 g/mol. Its IUPAC name is 3-[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111308867 |
| Molecular Formula | C21H36IN5O2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 3-[[N-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCC(c1ccc(OC)cc1)N1CCCCC1.I |
| InChI | InChI=1S/C21H35N5O2.HI/c1-22-21(23-13-12-20(27)25(2)3)24-16-19(26-14-6-5-7-15-26)17-8-10-18(28-4)11-9-17;/h8-11,19H,5-7,12-16H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CRDCJOVEGQFSFL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|