C20H31F3N4O3 — CID 111309240
1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111309240) has the molecular formula C20H31F3N4O3 and a molecular weight of 432.49 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111309240 |
| Molecular Formula | C20H31F3N4O3 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)NCC(c1ccc(OC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H31F3N4O3/c1-24-19(25-8-3-11-30-15-20(21,22)23)26-14-18(27-9-12-29-13-10-27)16-4-6-17(28-2)7-5-16/h4-7,18H,3,8-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | KTWLVISBJGHWOJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|