C20H33IN4O4 — CID 111310051
methyl 3-[[N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111310051) has the molecular formula C20H33IN4O4 and a molecular weight of 520.41 g/mol. Its IUPAC name is methyl 3-[[N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111310051 |
| Molecular Formula | C20H33IN4O4 |
| Molecular Weight | 520.41 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | methyl 3-[[N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | C/N=C(\NCC(C)C(=O)OC)NCC(c1ccc(OC)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C20H32N4O4.HI/c1-15(19(25)27-4)13-22-20(21-2)23-14-18(24-9-11-28-12-10-24)16-5-7-17(26-3)8-6-16;/h5-8,15,18H,9-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | BKZNVNNOJGGWGM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|