C22H27FN6S — CID 111310892
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111310892) has the molecular formula C22H27FN6S and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111310892 |
| Molecular Formula | C22H27FN6S |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN6S/c1-2-25-22(26-11-4-12-30-21-9-7-20(23)8-10-21)27-14-18-5-3-6-19(13-18)15-29-17-24-16-28-29/h3,5-10,13,16-17H,2,4,11-12,14-15H2,1H3,(H2,25,26,27) |
| InChIKey | YAOOKZDMRDHLEX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|