C21H22O3 — CID 11131091
(1S,2S,6S,7R,8S)-6,8-dimethyl-7-phenyl-4-oxatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene-3,5-dione (PubChem CID 11131091) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is (1S,2S,6S,7R,8S)-6,8-dimethyl-7-phenyl-4-oxatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene-3,5-dione.
| Compound Name | (1S,2S,6S,7R,8S)-6,8-dimethyl-7-phenyl-4-oxatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene-3,5-dione |
|---|---|
| PubChem CID | 11131091 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (1S,2S,6S,7R,8S)-6,8-dimethyl-7-phenyl-4-oxatetracyclo[5.5.2.01,8.02,6]tetradec-13-ene-3,5-dione |
| SMILES | C[C@]12CCCC[C@@]13C=C[C@]2(c1ccccc1)[C@@]1(C)C(=O)OC(=O)[C@H]13 |
| InChI | InChI=1S/C21H22O3/c1-18-10-6-7-11-20(18)12-13-21(18,14-8-4-3-5-9-14)19(2)15(20)16(22)24-17(19)23/h3-5,8-9,12-13,15H,6-7,10-11H2,1-2H3/t15-,18+,19-,20+,21-/m1/s1 |
| InChIKey | OMEWNRJQWJEPJN-VHQPJYBDSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|