C19H29FN4OS — CID 111311362
N-cyclohexyl-2-[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111311362) has the molecular formula C19H29FN4OS and a molecular weight of 380.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111311362 |
| Molecular Formula | C19H29FN4OS |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-cyclohexyl-2-[[N-[3-(4-fluorophenyl)sulfanylpropyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCCSc1ccc(F)cc1)NCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H29FN4OS/c1-21-19(23-14-18(25)24-16-6-3-2-4-7-16)22-12-5-13-26-17-10-8-15(20)9-11-17/h8-11,16H,2-7,12-14H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | IOUBJJJHHFEBNJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|