C20H32FIN4OS — CID 111311449
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide (PubChem CID 111311449) has the molecular formula C20H32FIN4OS and a molecular weight of 522.47 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111311449 |
| Molecular Formula | C20H32FIN4OS |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CN2CCCC2CO1)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C20H31FN4OS.HI/c1-2-22-20(23-10-4-12-27-19-8-6-16(21)7-9-19)24-13-18-14-25-11-3-5-17(25)15-26-18;/h6-9,17-18H,2-5,10-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZSVAFSUBAJGJLC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|