C21H29FN4O3 — CID 111312416
1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine (PubChem CID 111312416) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111312416 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-ethyl-2-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N1CCOCC1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C21H29FN4O3/c1-2-23-21(25-15-19(27)20-4-3-11-29-20)24-14-18(26-9-12-28-13-10-26)16-5-7-17(22)8-6-16/h3-8,11,18-19,27H,2,9-10,12-15H2,1H3,(H2,23,24,25) |
| InChIKey | MARKTKLPWDZYFW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|