About 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate
5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate (PubChem CID 11131312) has the molecular formula C15H23NO3S2
and a molecular weight of 329.49 g/mol. Its IUPAC name is 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate.
Molecular Properties
| Compound Name | 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate |
| PubChem CID | 11131312 |
| Molecular Formula | C15H23NO3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate |
| SMILES | C=CC(CCC)C(CCC)OC(=O)On1c(C)csc1=S |
| InChI | InChI=1S/C15H23NO3S2/c1-5-8-12(7-3)13(9-6-2)18-15(17)19-16-11(4)10-21-14(16)20/h7,10,12-13H,3,5-6,8-9H2,1-2,4H3 |
| InChIKey | KEKIJJWBGKELDE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate?
The IUPAC name of 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate (CID 11131312) is 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate.
What is the SMILES notation for 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate?
The canonical SMILES for 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate is C=CC(CCC)C(CCC)OC(=O)On1c(C)csc1=S.
What is the InChIKey of 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate?
The InChIKey is KEKIJJWBGKELDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3S2/c1-5-8-12(7-3)13(9-6-2)18-15(17)19-16-11(4)10-21-14(16)20/h7,10,12-13H,3,5-6,8-9H2,1-2,4H3.
What are the key properties of 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate?
5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate has a molecular weight of 329.49 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyloctan-4-yl (4-methyl-2-sulfanylidene-1,3-thiazol-3-yl) carbonate is sourced from PubChem (CID 11131312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).