C8H3F9N2O2 — CID 11131320
5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrimidine-2,4-dione (PubChem CID 11131320) has the molecular formula C8H3F9N2O2 and a molecular weight of 330.11 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11131320 |
| Molecular Formula | C8H3F9N2O2 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C8H3F9N2O2/c9-5(10,2-1-18-4(21)19-3(2)20)6(11,12)7(13,14)8(15,16)17/h1H,(H2,18,19,20,21) |
| InChIKey | RXUXOXUTRBXSOE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|