C19H32IN5O2 — CID 111313785
4-[[[ethylamino-[(2-methyl-2-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111313785) has the molecular formula C19H32IN5O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is 4-[[[ethylamino-[(2-methyl-2-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[ethylamino-[(2-methyl-2-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111313785 |
| Molecular Formula | C19H32IN5O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[[[ethylamino-[(2-methyl-2-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCC(C)(C)N1CCOCC1.I |
| InChI | InChI=1S/C19H31N5O2.HI/c1-4-21-18(22-13-15-5-7-16(8-6-15)17(20)25)23-14-19(2,3)24-9-11-26-12-10-24;/h5-8H,4,9-14H2,1-3H3,(H2,20,25)(H2,21,22,23);1H |
| InChIKey | QVYJUNYPOZAYLW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|