About 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one
3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one (PubChem CID 11131387) has the molecular formula C22H20OS
and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one |
| PubChem CID | 11131387 |
| Molecular Formula | C22H20OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one |
| SMILES | Cc1ccc(SC(CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20OS/c1-17-12-14-20(15-13-17)24-22(19-10-6-3-7-11-19)16-21(23)18-8-4-2-5-9-18/h2-15,22H,16H2,1H3 |
| InChIKey | BRJYNDCGYYLNON-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one?
The IUPAC name of 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one (CID 11131387) is 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one.
What is the SMILES notation for 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one?
The canonical SMILES for 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one is Cc1ccc(SC(CC(=O)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one?
The InChIKey is BRJYNDCGYYLNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20OS/c1-17-12-14-20(15-13-17)24-22(19-10-6-3-7-11-19)16-21(23)18-8-4-2-5-9-18/h2-15,22H,16H2,1H3.
What are the key properties of 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one?
3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one has a molecular weight of 332.47 g/mol, XLogP of 6.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)sulfanyl-1,3-diphenylpropan-1-one is sourced from PubChem (CID 11131387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).