C14H8BrNO4 — CID 11131422
3-(7-bromo-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 11131422) has the molecular formula C14H8BrNO4 and a molecular weight of 334.13 g/mol. Its IUPAC name is 3-(7-bromo-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-(7-bromo-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11131422 |
| Molecular Formula | C14H8BrNO4 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 3-(7-bromo-1H-indol-3-yl)-2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(O)C(=O)C(c2c[nH]c3c(Br)cccc23)=C1O |
| InChI | InChI=1S/C14H8BrNO4/c15-8-3-1-2-6-7(5-16-12(6)8)11-13(19)9(17)4-10(18)14(11)20/h1-5,16-17,20H |
| InChIKey | YMHSOHMFOXWBIZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|