About N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine
N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine (PubChem CID 11131488) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine |
| PubChem CID | 11131488 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine |
| SMILES | C/N=C1/C=C(NC(C)(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C13H24N2/c1-12(2,3)15-11-7-10(14-6)8-13(4,5)9-11/h7,15H,8-9H2,1-6H3/b14-10- |
| InChIKey | GNJDUSLWENYLID-UVTDQMKNSA-N |
| XLogP | 3.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine?
The IUPAC name of N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine (CID 11131488) is N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine.
What is the SMILES notation for N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine?
The canonical SMILES for N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine is C/N=C1/C=C(NC(C)(C)C)CC(C)(C)C1.
What is the InChIKey of N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine?
The InChIKey is GNJDUSLWENYLID-UVTDQMKNSA-N. The full InChI is InChI=1S/C13H24N2/c1-12(2,3)15-11-7-10(14-6)8-13(4,5)9-11/h7,15H,8-9H2,1-6H3/b14-10-.
What are the key properties of N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine?
N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine has a molecular weight of 208.35 g/mol, XLogP of 3.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5,5-dimethyl-3-methyliminocyclohexen-1-amine is sourced from PubChem (CID 11131488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).