C15H33N5O3S — CID 111315226
1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111315226) has the molecular formula C15H33N5O3S and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111315226 |
| Molecular Formula | C15H33N5O3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[3-(ethylsulfonylamino)propyl]-2-methyl-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(=N\C)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C15H33N5O3S/c1-5-24(21,22)19-8-6-7-17-14(16-4)18-13-15(2,3)20-9-11-23-12-10-20/h19H,5-13H2,1-4H3,(H2,16,17,18) |
| InChIKey | HEYLZAJULZHUBV-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|