About [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol
[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol (PubChem CID 11131629) has the molecular formula C21H28O2Si
and a molecular weight of 340.54 g/mol. Its IUPAC name is [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol |
| PubChem CID | 11131629 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-16-18-14-17(18)15-22/h4-13,17-18,22H,14-16H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | UDQZGHRUSQGZFC-MSOLQXFVSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol?
The IUPAC name of [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol (CID 11131629) is [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol.
What is the SMILES notation for [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol?
The canonical SMILES for [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol is CC(C)(C)[Si](OC[C@@H]1C[C@@H]1CO)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol?
The InChIKey is UDQZGHRUSQGZFC-MSOLQXFVSA-N. The full InChI is InChI=1S/C21H28O2Si/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-16-18-14-17(18)15-22/h4-13,17-18,22H,14-16H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol?
[(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol has a molecular weight of 340.54 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanol is sourced from PubChem (CID 11131629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).