C15H18O7S — CID 11131668
[(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11131668) has the molecular formula C15H18O7S and a molecular weight of 342.37 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11131668 |
| Molecular Formula | C15H18O7S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [(3aR,6R,6aR)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C15H18O7S/c1-9-4-6-10(7-5-9)23(17,18)19-8-11-12-13(14(16)20-11)22-15(2,3)21-12/h4-7,11-13H,8H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | LPINTYGCWKERKL-JHJVBQTASA-N |
| XLogP | 1.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|