About tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane
tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane (PubChem CID 11131694) has the molecular formula C18H38O2Si2
and a molecular weight of 342.67 g/mol. Its IUPAC name is tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| PubChem CID | 11131694 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-17(2,3)21(7,8)19-15-13-11-12-14-16(15)20-22(9,10)18(4,5)6/h11-12,15-16H,13-14H2,1-10H3/t15-,16+ |
| InChIKey | GQTYLXNSEAFWCI-IYBDPMFKSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane (CID 11131694) is tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane is CC(C)(C)[Si](C)(C)O[C@H]1CC=CC[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane?
The InChIKey is GQTYLXNSEAFWCI-IYBDPMFKSA-N. The full InChI is InChI=1S/C18H38O2Si2/c1-17(2,3)21(7,8)19-15-13-11-12-14-16(15)20-22(9,10)18(4,5)6/h11-12,15-16H,13-14H2,1-10H3/t15-,16+.
What are the key properties of tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane?
tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane has a molecular weight of 342.67 g/mol, XLogP of 6.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1R,6S)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]oxy-dimethylsilane is sourced from PubChem (CID 11131694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).